N-(2,4-dimethylphenyl)-2-(2-methyl-9-oxoacridin-10(9H)-yl)acetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-(2-methyl-9-oxoacridin-10(9H)-yl)acetamide
N-(2,4-dimethylphenyl)-2-(2-methyl-9-oxoacridin-10(9H)-yl)acetamide
Compound characteristics
| Compound ID: | 3764-6462 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-(2-methyl-9-oxoacridin-10(9H)-yl)acetamide |
| Molecular Weight: | 370.45 |
| Molecular Formula: | C24 H22 N2 O2 |
| Smiles: | Cc1ccc(c(C)c1)NC(CN1c2ccccc2C(c2cc(C)ccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7175 |
| logD: | 4.7175 |
| logSw: | -4.4788 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.883 |
| InChI Key: | GFIZOLZVUKIWDP-UHFFFAOYSA-N |