2-cyano-N-(4-cyanophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide
Chemical Structure Depiction of
2-cyano-N-(4-cyanophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide
2-cyano-N-(4-cyanophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide
Compound characteristics
| Compound ID: | 3772-7406 |
| Compound Name: | 2-cyano-N-(4-cyanophenyl)-3-(5-phenylfuran-2-yl)prop-2-enamide |
| Molecular Weight: | 339.35 |
| Molecular Formula: | C21 H13 N3 O2 |
| Smiles: | C(=C(/C#N)C(Nc1ccc(C#N)cc1)=O)/c1ccc(c2ccccc2)o1 |
| Stereo: | ACHIRAL |
| logP: | 4.2866 |
| logD: | 4.1031 |
| logSw: | -4.5706 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.012 |
| InChI Key: | WZYNKTFTGOFYDA-UHFFFAOYSA-N |