methyl 2-(4-tert-butylbenzamido)-4,5-dimethylthiophene-3-carboxylate
Chemical Structure Depiction of
methyl 2-(4-tert-butylbenzamido)-4,5-dimethylthiophene-3-carboxylate
methyl 2-(4-tert-butylbenzamido)-4,5-dimethylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | 3772-8407 |
| Compound Name: | methyl 2-(4-tert-butylbenzamido)-4,5-dimethylthiophene-3-carboxylate |
| Molecular Weight: | 345.46 |
| Molecular Formula: | C19 H23 N O3 S |
| Smiles: | Cc1c(C(=O)OC)c(NC(c2ccc(cc2)C(C)(C)C)=O)sc1C |
| Stereo: | ACHIRAL |
| logP: | 5.0941 |
| logD: | 1.3176 |
| logSw: | -5.0878 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.298 |
| InChI Key: | TYENUGQNBZKZRD-UHFFFAOYSA-N |