2-(4-methoxyphenoxy)-N-[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide
Chemical Structure Depiction of
2-(4-methoxyphenoxy)-N-[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide
2-(4-methoxyphenoxy)-N-[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide
Compound characteristics
| Compound ID: | 3777-1821 |
| Compound Name: | 2-(4-methoxyphenoxy)-N-[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]acetamide |
| Molecular Weight: | 402.45 |
| Molecular Formula: | C24 H22 N2 O4 |
| Smiles: | Cc1ccc2c(c1)nc(c1cccc(c1C)NC(COc1ccc(cc1)OC)=O)o2 |
| Stereo: | ACHIRAL |
| logP: | 4.8872 |
| logD: | 4.8872 |
| logSw: | -4.5263 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.272 |
| InChI Key: | NWZDAPQNTRVSIS-UHFFFAOYSA-N |