1-(2,3-dimethyl-1H-indol-1-yl)-2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]ethan-1-one
Chemical Structure Depiction of
1-(2,3-dimethyl-1H-indol-1-yl)-2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]ethan-1-one
1-(2,3-dimethyl-1H-indol-1-yl)-2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]ethan-1-one
Compound characteristics
| Compound ID: | 3785-0373 |
| Compound Name: | 1-(2,3-dimethyl-1H-indol-1-yl)-2-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]ethan-1-one |
| Molecular Weight: | 396.53 |
| Molecular Formula: | C21 H20 N2 O2 S2 |
| Smiles: | CCOc1ccc2c(c1)sc(n2)SCC(n1c(C)c(C)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.298 |
| logD: | 5.298 |
| logSw: | -5.5175 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.0558 |
| InChI Key: | UUDRLFYQUXPAFU-UHFFFAOYSA-N |