(4-benzylpiperazin-1-yl)(4-{[(4-chlorophenyl)sulfanyl]methyl}phenyl)methanone
Chemical Structure Depiction of
(4-benzylpiperazin-1-yl)(4-{[(4-chlorophenyl)sulfanyl]methyl}phenyl)methanone
(4-benzylpiperazin-1-yl)(4-{[(4-chlorophenyl)sulfanyl]methyl}phenyl)methanone
Compound characteristics
| Compound ID: | 3788-2254 |
| Compound Name: | (4-benzylpiperazin-1-yl)(4-{[(4-chlorophenyl)sulfanyl]methyl}phenyl)methanone |
| Molecular Weight: | 437 |
| Molecular Formula: | C25 H25 Cl N2 O S |
| Smiles: | C1CN(CCN1Cc1ccccc1)C(c1ccc(CSc2ccc(cc2)[Cl])cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6548 |
| logD: | 4.6393 |
| logSw: | -4.9967 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 20.1556 |
| InChI Key: | ZXJKDTHJZNLGNL-UHFFFAOYSA-N |