N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-3,4,5-trimethoxybenzamide
N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | 3800-1357 |
| Compound Name: | N-[2-(4-fluorophenyl)-2H-benzotriazol-5-yl]-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 422.41 |
| Molecular Formula: | C22 H19 F N4 O4 |
| Smiles: | COc1cc(cc(c1OC)OC)C(Nc1ccc2c(c1)nn(c1ccc(cc1)F)n2)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1051 |
| logD: | 4.1047 |
| logSw: | -4.3655 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.342 |
| InChI Key: | SCVXUZALFYWQGU-UHFFFAOYSA-N |