N-{2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoyl}valine
Chemical Structure Depiction of
N-{2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoyl}valine
N-{2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoyl}valine
Compound characteristics
| Compound ID: | 3802-0176 |
| Compound Name: | N-{2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoyl}valine |
| Molecular Weight: | 435.27 |
| Molecular Formula: | C19 H19 Br N2 O5 |
| Smiles: | CC(C)C(C(O)=O)NC(/C(=C/c1ccccc1)NC(c1ccc(o1)[Br])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.9649 |
| logD: | -1.3712 |
| logSw: | -2.4601 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 83.534 |
| InChI Key: | NKAGYMZRPRVCBQ-INIZCTEOSA-N |