2-(2,4-dichlorophenoxy)-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one
Chemical Structure Depiction of
2-(2,4-dichlorophenoxy)-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one
2-(2,4-dichlorophenoxy)-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | 3807-3967 |
| Compound Name: | 2-(2,4-dichlorophenoxy)-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one |
| Molecular Weight: | 618.6 |
| Molecular Formula: | C39 H33 Cl2 N O2 |
| Smiles: | CC1=CC(C)(C)N(C(COc2ccc(cc2[Cl])[Cl])=O)c2ccc(cc12)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 10.2329 |
| logD: | 10.2329 |
| logSw: | -6.2786 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 20.5678 |
| InChI Key: | MMLRFOARXWDITH-UHFFFAOYSA-N |