2-(2-methoxyphenyl)-4,4,7-trimethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione
Chemical Structure Depiction of
2-(2-methoxyphenyl)-4,4,7-trimethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione
2-(2-methoxyphenyl)-4,4,7-trimethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione
Compound characteristics
| Compound ID: | 3807-4969 |
| Compound Name: | 2-(2-methoxyphenyl)-4,4,7-trimethyl-4,5-dihydro[1,2]thiazolo[5,4-c]quinoline-1(2H)-thione |
| Molecular Weight: | 368.52 |
| Molecular Formula: | C20 H20 N2 O S2 |
| Smiles: | Cc1ccc2C3=C(C(C)(C)Nc2c1)SN(C3=S)c1ccccc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.8265 |
| logD: | 3.2806 |
| logSw: | -4.6016 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 22.0353 |
| InChI Key: | WXWFRUFWNHYHLL-UHFFFAOYSA-N |