2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one
Chemical Structure Depiction of
2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one
2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one
Compound characteristics
| Compound ID: | 3807-5270 |
| Compound Name: | 2-[(4,5-dihydro-1,3-thiazol-2-yl)sulfanyl]-1-[2,2,4-trimethyl-6-(triphenylmethyl)quinolin-1(2H)-yl]ethan-1-one |
| Molecular Weight: | 574.81 |
| Molecular Formula: | C36 H34 N2 O S2 |
| Smiles: | CC1=CC(C)(C)N(C(CSC2=NCCS2)=O)c2ccc(cc12)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 8.9041 |
| logD: | 8.9024 |
| logSw: | -5.6856 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 22.6957 |
| InChI Key: | OJICOHXHWWAWSU-UHFFFAOYSA-N |