2-butyl-3-(3-hydroxyphenyl)quinazolin-4(3H)-one
Chemical Structure Depiction of
2-butyl-3-(3-hydroxyphenyl)quinazolin-4(3H)-one
2-butyl-3-(3-hydroxyphenyl)quinazolin-4(3H)-one
Compound characteristics
| Compound ID: | 3807-5911 |
| Compound Name: | 2-butyl-3-(3-hydroxyphenyl)quinazolin-4(3H)-one |
| Molecular Weight: | 294.35 |
| Molecular Formula: | C18 H18 N2 O2 |
| Smiles: | CCCCC1=Nc2ccccc2C(N1c1cccc(c1)O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0302 |
| logD: | 3.0097 |
| logSw: | -3.2856 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.483 |
| InChI Key: | LNAVBMUYDPGILK-UHFFFAOYSA-N |