2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2,3-dimethylphenyl)acetamide
Chemical Structure Depiction of
2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2,3-dimethylphenyl)acetamide
2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2,3-dimethylphenyl)acetamide
Compound characteristics
| Compound ID: | 3809-1095 |
| Compound Name: | 2-{[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl}-N-(2,3-dimethylphenyl)acetamide |
| Molecular Weight: | 486.59 |
| Molecular Formula: | C27 H26 N4 O3 S |
| Smiles: | Cc1cccc(c1C)NC(CSc1nc(c2ccc(cc2)OC)c(c2ccc(cc2)OC)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2283 |
| logD: | 5.2283 |
| logSw: | -5.0063 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.924 |
| InChI Key: | BWAQIHCGSSZLLD-UHFFFAOYSA-N |