(4-methylphenyl)({[phenyl(pyridin-3-yl)methylidene]amino}oxy)methanone
Chemical Structure Depiction of
(4-methylphenyl)({[phenyl(pyridin-3-yl)methylidene]amino}oxy)methanone
(4-methylphenyl)({[phenyl(pyridin-3-yl)methylidene]amino}oxy)methanone
Compound characteristics
| Compound ID: | 3843-0569 |
| Compound Name: | (4-methylphenyl)({[phenyl(pyridin-3-yl)methylidene]amino}oxy)methanone |
| Molecular Weight: | 316.36 |
| Molecular Formula: | C20 H16 N2 O2 |
| Smiles: | Cc1ccc(cc1)C(=O)O/N=C(\c1ccccc1)c1cccnc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6659 |
| logD: | 3.6659 |
| logSw: | -3.4446 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 41.025 |
| InChI Key: | YIEOLLUIDBCEAZ-UHFFFAOYSA-N |