2-(3-methylphenyl)hexahydro-4,6-ethenocyclopropa[f]isoindole-1,3(2H,3aH)-dione
Chemical Structure Depiction of
2-(3-methylphenyl)hexahydro-4,6-ethenocyclopropa[f]isoindole-1,3(2H,3aH)-dione
2-(3-methylphenyl)hexahydro-4,6-ethenocyclopropa[f]isoindole-1,3(2H,3aH)-dione
Compound characteristics
| Compound ID: | 3849-0232 |
| Compound Name: | 2-(3-methylphenyl)hexahydro-4,6-ethenocyclopropa[f]isoindole-1,3(2H,3aH)-dione |
| Molecular Weight: | 279.34 |
| Molecular Formula: | C18 H17 N O2 |
| Smiles: | Cc1cccc(c1)N1C(C2C3C=CC(C4CC34)C2C1=O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.3179 |
| logD: | 2.3179 |
| logSw: | -2.523 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.2442 |
| InChI Key: | UDUWKOSPPFZGMW-UHFFFAOYSA-N |