{3-benzoyl-2-[4-(diethylamino)phenyl]imidazolidin-1-yl}(4-methylphenyl)methanone
Chemical Structure Depiction of
{3-benzoyl-2-[4-(diethylamino)phenyl]imidazolidin-1-yl}(4-methylphenyl)methanone
{3-benzoyl-2-[4-(diethylamino)phenyl]imidazolidin-1-yl}(4-methylphenyl)methanone
Compound characteristics
| Compound ID: | 3858-0296 |
| Compound Name: | {3-benzoyl-2-[4-(diethylamino)phenyl]imidazolidin-1-yl}(4-methylphenyl)methanone |
| Molecular Weight: | 441.57 |
| Molecular Formula: | C28 H31 N3 O2 |
| Smiles: | CCN(CC)c1ccc(cc1)C1N(CCN1C(c1ccc(C)cc1)=O)C(c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2633 |
| logD: | 4.8167 |
| logSw: | -5.2164 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.315 |
| InChI Key: | PCRAIZZSKAOEGE-SANMLTNESA-N |