1-butyl-2-[(2,4-dichlorophenoxy)methyl]-1H-benzimidazole
Chemical Structure Depiction of
1-butyl-2-[(2,4-dichlorophenoxy)methyl]-1H-benzimidazole
1-butyl-2-[(2,4-dichlorophenoxy)methyl]-1H-benzimidazole
Compound characteristics
| Compound ID: | 3906-0710 |
| Compound Name: | 1-butyl-2-[(2,4-dichlorophenoxy)methyl]-1H-benzimidazole |
| Molecular Weight: | 349.26 |
| Molecular Formula: | C18 H18 Cl2 N2 O |
| Smiles: | CCCCn1c2ccccc2nc1COc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.6811 |
| logD: | 5.6811 |
| logSw: | -5.873 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 18.7074 |
| InChI Key: | VMSPXHCPCJAKJL-UHFFFAOYSA-N |