propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate--hydrogen chloride (1/1)
Chemical Structure Depiction of
propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate--hydrogen chloride (1/1)
propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 3910-0406 |
| Compound Name: | propyl 4-[3-(4-benzoylpiperazin-1-yl)-2-hydroxypropoxy]benzoate--hydrogen chloride (1/1) |
| Molecular Weight: | 462.97 |
| Molecular Formula: | C24 H30 N2 O5 |
| Salt: | HCl |
| Smiles: | CCCOC(c1ccc(cc1)OCC(CN1CCN(CC1)C(c1ccccc1)=O)O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.231 |
| logD: | 3.223 |
| logSw: | -3.0369 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.594 |
| InChI Key: | JIZZMPKMGFYVDE-NRFANRHFSA-N |