butyl {4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl}carbamate
Chemical Structure Depiction of
butyl {4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl}carbamate
butyl {4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl}carbamate
Compound characteristics
| Compound ID: | 3931-1418 |
| Compound Name: | butyl {4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl}carbamate |
| Molecular Weight: | 378.45 |
| Molecular Formula: | C17 H22 N4 O4 S |
| Smiles: | CCCCOC(Nc1ccc(cc1)S(Nc1cc(C)nc(C)n1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8942 |
| logD: | 2.0239 |
| logSw: | -3.4167 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 91.184 |
| InChI Key: | REPZSEUIGAYDBG-UHFFFAOYSA-N |