3-{1-(benzenesulfonyl)-5-[4-(dimethylamino)phenyl]-4,5-dihydro-1H-pyrazol-3-yl}-6-chloro-4-phenylquinolin-2(1H)-one
Chemical Structure Depiction of
3-{1-(benzenesulfonyl)-5-[4-(dimethylamino)phenyl]-4,5-dihydro-1H-pyrazol-3-yl}-6-chloro-4-phenylquinolin-2(1H)-one
3-{1-(benzenesulfonyl)-5-[4-(dimethylamino)phenyl]-4,5-dihydro-1H-pyrazol-3-yl}-6-chloro-4-phenylquinolin-2(1H)-one
Compound characteristics
| Compound ID: | 3932-0060 |
| Compound Name: | 3-{1-(benzenesulfonyl)-5-[4-(dimethylamino)phenyl]-4,5-dihydro-1H-pyrazol-3-yl}-6-chloro-4-phenylquinolin-2(1H)-one |
| Molecular Weight: | 583.11 |
| Molecular Formula: | C32 H27 Cl N4 O3 S |
| Smiles: | CN(C)c1ccc(cc1)C1CC(C2=C(c3ccccc3)c3cc(ccc3NC2=O)[Cl])=NN1S(c1ccccc1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.5786 |
| logD: | 6.491 |
| logSw: | -6.2772 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.762 |
| InChI Key: | ICAVRYIXMKMQNC-GDLZYMKVSA-N |