N-[2-(4-benzoylpiperazin-1-yl)-1,2-dihydroacenaphthylen-1-yl]-4-chlorobenzene-1-sulfonamide
					Chemical Structure Depiction of
N-[2-(4-benzoylpiperazin-1-yl)-1,2-dihydroacenaphthylen-1-yl]-4-chlorobenzene-1-sulfonamide
			N-[2-(4-benzoylpiperazin-1-yl)-1,2-dihydroacenaphthylen-1-yl]-4-chlorobenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 3940-0035 | 
| Compound Name: | N-[2-(4-benzoylpiperazin-1-yl)-1,2-dihydroacenaphthylen-1-yl]-4-chlorobenzene-1-sulfonamide | 
| Molecular Weight: | 532.06 | 
| Molecular Formula: | C29 H26 Cl N3 O3 S | 
| Smiles: | C1CN(CCN1C1C(c2cccc3cccc1c23)NS(c1ccc(cc1)[Cl])(=O)=O)C(c1ccccc1)=O | 
| Stereo: | MIXTURE OF STEREOISOMERS | 
| logP: | 5.1635 | 
| logD: | 5.1626 | 
| logSw: | -5.9404 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 61.019 | 
| InChI Key: | LURRKJZWONROKU-UHFFFAOYSA-N | 
 
				 
				