N'-{[2-(benzyloxy)phenyl]methylidene}furan-2-carbohydrazide
Chemical Structure Depiction of
N'-{[2-(benzyloxy)phenyl]methylidene}furan-2-carbohydrazide
N'-{[2-(benzyloxy)phenyl]methylidene}furan-2-carbohydrazide
Compound characteristics
| Compound ID: | 3958-2033 |
| Compound Name: | N'-{[2-(benzyloxy)phenyl]methylidene}furan-2-carbohydrazide |
| Molecular Weight: | 320.35 |
| Molecular Formula: | C19 H16 N2 O3 |
| Smiles: | C(c1ccccc1)Oc1ccccc1\C=N/NC(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1995 |
| logD: | 4.1987 |
| logSw: | -4.6116 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.447 |
| InChI Key: | MAPGJTRWHKGPAZ-UHFFFAOYSA-N |