methyl 4-[(9H-xanthene-9-carbonyl)amino]benzoate
Chemical Structure Depiction of
methyl 4-[(9H-xanthene-9-carbonyl)amino]benzoate
methyl 4-[(9H-xanthene-9-carbonyl)amino]benzoate
Compound characteristics
| Compound ID: | 3966-2794 |
| Compound Name: | methyl 4-[(9H-xanthene-9-carbonyl)amino]benzoate |
| Molecular Weight: | 359.38 |
| Molecular Formula: | C22 H17 N O4 |
| Smiles: | COC(c1ccc(cc1)NC(C1c2ccccc2Oc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.225 |
| logD: | -3.0756 |
| logSw: | -4.6863 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.317 |
| InChI Key: | HQLZTBZBGMIUDT-UHFFFAOYSA-N |