6-[(1,3-benzothiazol-2-yl)sulfanyl]-N~2~,N~4~-bis[4-(diethylamino)phenyl]-1,3,5-triazine-2,4-diamine
Chemical Structure Depiction of
6-[(1,3-benzothiazol-2-yl)sulfanyl]-N~2~,N~4~-bis[4-(diethylamino)phenyl]-1,3,5-triazine-2,4-diamine
6-[(1,3-benzothiazol-2-yl)sulfanyl]-N~2~,N~4~-bis[4-(diethylamino)phenyl]-1,3,5-triazine-2,4-diamine
Compound characteristics
| Compound ID: | 3966-3256 |
| Compound Name: | 6-[(1,3-benzothiazol-2-yl)sulfanyl]-N~2~,N~4~-bis[4-(diethylamino)phenyl]-1,3,5-triazine-2,4-diamine |
| Molecular Weight: | 570.78 |
| Molecular Formula: | C30 H34 N8 S2 |
| Smiles: | CCN(CC)c1ccc(cc1)Nc1nc(Nc2ccc(cc2)N(CC)CC)nc(n1)Sc1nc2ccccc2s1 |
| Stereo: | ACHIRAL |
| logP: | 9.5015 |
| logD: | 9.2653 |
| logSw: | -6.0962 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.202 |
| InChI Key: | OTSTWSJCCLACGB-UHFFFAOYSA-N |