1-(4-bromo-3-methylphenyl)-5-{[4-(diethylamino)phenyl]methylidene}-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
1-(4-bromo-3-methylphenyl)-5-{[4-(diethylamino)phenyl]methylidene}-1,3-diazinane-2,4,6-trione
1-(4-bromo-3-methylphenyl)-5-{[4-(diethylamino)phenyl]methylidene}-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3970-1266 |
| Compound Name: | 1-(4-bromo-3-methylphenyl)-5-{[4-(diethylamino)phenyl]methylidene}-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 456.34 |
| Molecular Formula: | C22 H22 Br N3 O3 |
| Smiles: | CCN(CC)c1ccc(\C=C2/C(NC(N(C2=O)c2ccc(c(C)c2)[Br])=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.5196 |
| logD: | 4.4414 |
| logSw: | -4.2879 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.127 |
| InChI Key: | MRIZTZSLVFFPTN-UHFFFAOYSA-N |