5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1-methyl-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1-methyl-1,3-diazinane-2,4,6-trione
5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1-methyl-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 3970-2142 |
| Compound Name: | 5-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylidene]-1-methyl-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 335.27 |
| Molecular Formula: | C14 H13 N3 O7 |
| Smiles: | CCOc1cc(\C=C2/C(NC(N(C)C2=O)=O)=O)cc(c1O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 1.5926 |
| logD: | 0.7676 |
| logSw: | -2.3976 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 109.81 |
| InChI Key: | JYRRXPCYOSXJHO-UHFFFAOYSA-N |