2,4-dichloro-6-{[(1-ethyl-1H-benzimidazol-2-yl)amino]methyl}phenol
Chemical Structure Depiction of
2,4-dichloro-6-{[(1-ethyl-1H-benzimidazol-2-yl)amino]methyl}phenol
2,4-dichloro-6-{[(1-ethyl-1H-benzimidazol-2-yl)amino]methyl}phenol
Compound characteristics
| Compound ID: | 3988-0473 |
| Compound Name: | 2,4-dichloro-6-{[(1-ethyl-1H-benzimidazol-2-yl)amino]methyl}phenol |
| Molecular Weight: | 336.22 |
| Molecular Formula: | C16 H15 Cl2 N3 O |
| Smiles: | CCn1c2ccccc2nc1NCc1cc(cc(c1O)[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.9648 |
| logD: | 4.8535 |
| logSw: | -4.6298 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 37.785 |
| InChI Key: | VGNDLPHXJKLKMF-UHFFFAOYSA-N |