N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide
Compound characteristics
| Compound ID: | 3993-2468 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide |
| Molecular Weight: | 443.59 |
| Molecular Formula: | C22 H25 N3 O3 S2 |
| Smiles: | COc1ccc(CCNC(CSc2c3c4CCCCc4sc3ncn2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.4012 |
| logD: | 3.4012 |
| logSw: | -4.1007 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.507 |
| InChI Key: | BWYINQTWAPYIEQ-UHFFFAOYSA-N |