3-anilino-6-methyl-1,2,4-triazin-5(4H)-one
Chemical Structure Depiction of
3-anilino-6-methyl-1,2,4-triazin-5(4H)-one
3-anilino-6-methyl-1,2,4-triazin-5(4H)-one
Compound characteristics
| Compound ID: | 3993-4001 |
| Compound Name: | 3-anilino-6-methyl-1,2,4-triazin-5(4H)-one |
| Molecular Weight: | 202.21 |
| Molecular Formula: | C10 H10 N4 O |
| Smiles: | CC1C(NC(Nc2ccccc2)=NN=1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6512 |
| logD: | 1.6495 |
| logSw: | -1.9693 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.297 |
| InChI Key: | LXGRFUNPYMOOEB-UHFFFAOYSA-N |