3-chloro-4-(2,5-dimethoxyanilino)-1-(4-ethylphenyl)-1H-pyrrole-2,5-dione
Chemical Structure Depiction of
3-chloro-4-(2,5-dimethoxyanilino)-1-(4-ethylphenyl)-1H-pyrrole-2,5-dione
3-chloro-4-(2,5-dimethoxyanilino)-1-(4-ethylphenyl)-1H-pyrrole-2,5-dione
Compound characteristics
| Compound ID: | 3993-4126 |
| Compound Name: | 3-chloro-4-(2,5-dimethoxyanilino)-1-(4-ethylphenyl)-1H-pyrrole-2,5-dione |
| Molecular Weight: | 386.83 |
| Molecular Formula: | C20 H19 Cl N2 O4 |
| Smiles: | CCc1ccc(cc1)N1C(C(=C(C1=O)[Cl])Nc1cc(ccc1OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8561 |
| logD: | 3.3415 |
| logSw: | -4.3103 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.739 |
| InChI Key: | RKKBZWTZAJNQKX-UHFFFAOYSA-N |