2-cyano-N~1~-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-{5-[(4-methylphenyl)sulfanyl]-2-furyl}acrylamide
Chemical Structure Depiction of
2-cyano-N~1~-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-{5-[(4-methylphenyl)sulfanyl]-2-furyl}acrylamide
2-cyano-N~1~-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-{5-[(4-methylphenyl)sulfanyl]-2-furyl}acrylamide
Compound characteristics
| Compound ID: | 4011-0153 |
| Compound Name: | 2-cyano-N~1~-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-{5-[(4-methylphenyl)sulfanyl]-2-furyl}acrylamide |
| Molecular Weight: | 450.58 |
| Molecular Formula: | C23 H22 N4 O2 S2 |
| Smiles: | Cc1ccc(cc1)Sc1ccc(/C=C(/C#N)C(Nc2nnc(C3CCCCC3)s2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 6.82 |
| logD: | 4.89 |
| logSw: | -7.37 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 180.7 |
| InChI Key: | DOTLRBJLLNKXPQ-UHFFFAOYSA-N |