4-methyl-2-(4-phenyl-3H-1,5-benzodiazepin-2-yl)phenol
Chemical Structure Depiction of
4-methyl-2-(4-phenyl-3H-1,5-benzodiazepin-2-yl)phenol
4-methyl-2-(4-phenyl-3H-1,5-benzodiazepin-2-yl)phenol
Compound characteristics
| Compound ID: | 4019-0014 |
| Compound Name: | 4-methyl-2-(4-phenyl-3H-1,5-benzodiazepin-2-yl)phenol |
| Molecular Weight: | 326.4 |
| Molecular Formula: | C22 H18 N2 O |
| Smiles: | Cc1ccc(c(c1)C1CC(c2ccccc2)=Nc2ccccc2N=1)O |
| Stereo: | ACHIRAL |
| logP: | 5.1832 |
| logD: | 5.1592 |
| logSw: | -4.9686 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.318 |
| InChI Key: | AMFVPDLFNQOHOE-UHFFFAOYSA-N |