N-(4-fluorophenyl)-2-methyl-5-oxo-7-phenyl-4-(thiophen-3-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-2-methyl-5-oxo-7-phenyl-4-(thiophen-3-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide
N-(4-fluorophenyl)-2-methyl-5-oxo-7-phenyl-4-(thiophen-3-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | 4023-0859 |
| Compound Name: | N-(4-fluorophenyl)-2-methyl-5-oxo-7-phenyl-4-(thiophen-3-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide |
| Molecular Weight: | 458.55 |
| Molecular Formula: | C27 H23 F N2 O2 S |
| Smiles: | CC1=C(C(C2=C(CC(CC2=O)c2ccccc2)N1)c1ccsc1)C(Nc1ccc(cc1)F)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.4532 |
| logD: | 3.2783 |
| logSw: | -5.4367 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 47.759 |
| InChI Key: | VSMGWHOQUJNRJS-UHFFFAOYSA-N |