ethyl 4-[(3-methoxyphenyl)methylidene]-2-methyl-5-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 4-[(3-methoxyphenyl)methylidene]-2-methyl-5-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate
ethyl 4-[(3-methoxyphenyl)methylidene]-2-methyl-5-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | 4031-0327 |
| Compound Name: | ethyl 4-[(3-methoxyphenyl)methylidene]-2-methyl-5-oxo-1-phenyl-4,5-dihydro-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 363.41 |
| Molecular Formula: | C22 H21 N O4 |
| Smiles: | CCOC(C1/C(=C/c2cccc(c2)OC)C(N(C=1C)c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.777 |
| logD: | 3.777 |
| logSw: | -4.0167 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.623 |
| InChI Key: | QMIOMGQCHBMDSL-UHFFFAOYSA-N |