N~1~,N~2~-bis[(pyridin-3-yl)methyl]ethanediamide
Chemical Structure Depiction of
N~1~,N~2~-bis[(pyridin-3-yl)methyl]ethanediamide
N~1~,N~2~-bis[(pyridin-3-yl)methyl]ethanediamide
Compound characteristics
| Compound ID: | 4031-0664 |
| Compound Name: | N~1~,N~2~-bis[(pyridin-3-yl)methyl]ethanediamide |
| Molecular Weight: | 270.29 |
| Molecular Formula: | C14 H14 N4 O2 |
| Smiles: | C(c1cccnc1)NC(C(NCc1cccnc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | -0.5198 |
| logD: | -0.5221 |
| logSw: | -0.6904 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.372 |
| InChI Key: | BNXGAGLVOASELG-UHFFFAOYSA-N |