N~1~-(3,4-dimethylphenyl)-N~2~-[(oxolan-2-yl)methyl]ethanediamide
Chemical Structure Depiction of
N~1~-(3,4-dimethylphenyl)-N~2~-[(oxolan-2-yl)methyl]ethanediamide
N~1~-(3,4-dimethylphenyl)-N~2~-[(oxolan-2-yl)methyl]ethanediamide
Compound characteristics
| Compound ID: | 4031-1686 |
| Compound Name: | N~1~-(3,4-dimethylphenyl)-N~2~-[(oxolan-2-yl)methyl]ethanediamide |
| Molecular Weight: | 276.33 |
| Molecular Formula: | C15 H20 N2 O3 |
| Smiles: | Cc1ccc(cc1C)NC(C(NCC1CCCO1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7228 |
| logD: | 1.6393 |
| logSw: | -2.2616 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.669 |
| InChI Key: | YHNZOFJSWGMHLE-CYBMUJFWSA-N |