2,7-dimethyl-N'-[(thiophen-2-yl)methylidene]imidazo[1,2-a]pyridine-3-carbohydrazide
Chemical Structure Depiction of
2,7-dimethyl-N'-[(thiophen-2-yl)methylidene]imidazo[1,2-a]pyridine-3-carbohydrazide
2,7-dimethyl-N'-[(thiophen-2-yl)methylidene]imidazo[1,2-a]pyridine-3-carbohydrazide
Compound characteristics
| Compound ID: | 4031-2052 |
| Compound Name: | 2,7-dimethyl-N'-[(thiophen-2-yl)methylidene]imidazo[1,2-a]pyridine-3-carbohydrazide |
| Molecular Weight: | 298.36 |
| Molecular Formula: | C15 H14 N4 O S |
| Smiles: | Cc1ccn2c(C(N/N=C\c3cccs3)=O)c(C)nc2c1 |
| Stereo: | ACHIRAL |
| logP: | 2.7349 |
| logD: | 2.7348 |
| logSw: | -3.1493 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.536 |
| InChI Key: | VZZUVBBCDDRMGD-UHFFFAOYSA-N |