5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4032-1143 |
| Compound Name: | 5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 480.35 |
| Molecular Formula: | C21 H19 Br F N O4 S |
| Smiles: | CCOc1cc(/C=C2/C(N(Cc3ccc(cc3)F)C(=O)S2)=O)cc(c1OCC)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.5411 |
| logD: | 5.5411 |
| logSw: | -5.3878 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 44.103 |
| InChI Key: | ZDUKBNFJACRFAD-UHFFFAOYSA-N |