5-[(2,4-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-[(2,4-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
5-[(2,4-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4032-1242 |
| Compound Name: | 5-[(2,4-diethoxyphenyl)methylidene]-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 401.46 |
| Molecular Formula: | C21 H20 F N O4 S |
| Smiles: | CCOc1ccc(/C=C2/C(N(Cc3ccc(cc3)F)C(=O)S2)=O)c(c1)OCC |
| Stereo: | ACHIRAL |
| logP: | 5.2102 |
| logD: | 5.2102 |
| logSw: | -4.9854 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 43.929 |
| InChI Key: | ASRDWXSCWMVHQX-UHFFFAOYSA-N |