5-{[2,5-dimethyl-1-(2-methylphenyl)-1H-pyrrol-3-yl]methylidene}-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-{[2,5-dimethyl-1-(2-methylphenyl)-1H-pyrrol-3-yl]methylidene}-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
5-{[2,5-dimethyl-1-(2-methylphenyl)-1H-pyrrol-3-yl]methylidene}-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4032-1370 |
| Compound Name: | 5-{[2,5-dimethyl-1-(2-methylphenyl)-1H-pyrrol-3-yl]methylidene}-3-[(4-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 420.5 |
| Molecular Formula: | C24 H21 F N2 O2 S |
| Smiles: | Cc1ccccc1n1c(C)cc(/C=C2/C(N(Cc3ccc(cc3)F)C(=O)S2)=O)c1C |
| Stereo: | ACHIRAL |
| logP: | 5.5673 |
| logD: | 5.5673 |
| logSw: | -5.3622 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 31.959 |
| InChI Key: | FJTCFEAMBYDOLB-UHFFFAOYSA-N |