5-({5-bromo-2-[(3-fluorophenyl)methoxy]phenyl}methylidene)-3-[(4-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-({5-bromo-2-[(3-fluorophenyl)methoxy]phenyl}methylidene)-3-[(4-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione
5-({5-bromo-2-[(3-fluorophenyl)methoxy]phenyl}methylidene)-3-[(4-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4032-1557 |
| Compound Name: | 5-({5-bromo-2-[(3-fluorophenyl)methoxy]phenyl}methylidene)-3-[(4-chlorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 532.81 |
| Molecular Formula: | C24 H16 Br Cl F N O3 S |
| Smiles: | C(c1ccc(cc1)[Cl])N1C(/C(=C/c2cc(ccc2OCc2cccc(c2)F)[Br])SC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.6033 |
| logD: | 7.6033 |
| logSw: | -6.6466 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 36.91 |
| InChI Key: | MHGAZRAZZTYGOW-UHFFFAOYSA-N |