3-[(4-chlorophenyl)methyl]-5-[(3-ethoxy-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
3-[(4-chlorophenyl)methyl]-5-[(3-ethoxy-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione
3-[(4-chlorophenyl)methyl]-5-[(3-ethoxy-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 4032-1586 |
| Compound Name: | 3-[(4-chlorophenyl)methyl]-5-[(3-ethoxy-2-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 389.86 |
| Molecular Formula: | C19 H16 Cl N O4 S |
| Smiles: | CCOc1cccc(/C=C2/C(N(Cc3ccc(cc3)[Cl])C(=O)S2)=O)c1O |
| Stereo: | ACHIRAL |
| logP: | 5.0895 |
| logD: | 5.0663 |
| logSw: | -4.9858 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.285 |
| InChI Key: | OEVFACBZDNEDAW-UHFFFAOYSA-N |