2-(2,3-dimethoxyphenyl)-4-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole
Chemical Structure Depiction of
2-(2,3-dimethoxyphenyl)-4-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole
2-(2,3-dimethoxyphenyl)-4-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole
Compound characteristics
| Compound ID: | 4041-0182 |
| Compound Name: | 2-(2,3-dimethoxyphenyl)-4-phenyl-5-[3-(trifluoromethyl)phenyl]-1H-imidazole |
| Molecular Weight: | 424.42 |
| Molecular Formula: | C24 H19 F3 N2 O2 |
| Smiles: | COc1cccc(c1OC)c1nc(c2ccccc2)c(c2cccc(c2)C(F)(F)F)[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 5.8891 |
| logD: | 5.8831 |
| logSw: | -5.9239 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 35.902 |
| InChI Key: | VOPZBJWXMNHQEV-UHFFFAOYSA-N |