2-(3-bromo-4-methoxyphenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine
Chemical Structure Depiction of
2-(3-bromo-4-methoxyphenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine
2-(3-bromo-4-methoxyphenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine
Compound characteristics
| Compound ID: | 4052-4287 |
| Compound Name: | 2-(3-bromo-4-methoxyphenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine |
| Molecular Weight: | 540.23 |
| Molecular Formula: | C16 H15 Br I N O3 S2 |
| Smiles: | COc1ccc(cc1[Br])C1N(CCS1)S(c1ccc(cc1)I)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0123 |
| logD: | 5.0123 |
| logSw: | -4.792 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 40.147 |
| InChI Key: | JWBGUEXTWGWMFH-INIZCTEOSA-N |