2-(4-bromophenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine
Chemical Structure Depiction of
2-(4-bromophenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine
2-(4-bromophenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine
Compound characteristics
| Compound ID: | 4052-4295 |
| Compound Name: | 2-(4-bromophenyl)-3-(4-iodobenzene-1-sulfonyl)-1,3-thiazolidine |
| Molecular Weight: | 510.21 |
| Molecular Formula: | C15 H13 Br I N O2 S2 |
| Smiles: | C1CSC(c2ccc(cc2)[Br])N1S(c1ccc(cc1)I)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4577 |
| logD: | 5.4577 |
| logSw: | -5.8595 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 32.516 |
| InChI Key: | JZXAYFQNEZJIAZ-HNNXBMFYSA-N |