4-nitro-N-phenyl-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine
Chemical Structure Depiction of
4-nitro-N-phenyl-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine
4-nitro-N-phenyl-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine
Compound characteristics
| Compound ID: | 4061-0072 |
| Compound Name: | 4-nitro-N-phenyl-7-(piperidin-1-yl)-2,1,3-benzoxadiazol-5-amine |
| Molecular Weight: | 339.35 |
| Molecular Formula: | C17 H17 N5 O3 |
| Smiles: | C1CCN(CC1)c1cc(c(c2c1non2)[N+]([O-])=O)Nc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.1738 |
| logD: | 5.1738 |
| logSw: | -5.3573 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.244 |
| InChI Key: | PJHKWALJTNVQIV-UHFFFAOYSA-N |