2-{[2-(3,5-dichloropyridin-2-yl)hydrazinylidene]methyl}-4-methoxyphenol
Chemical Structure Depiction of
2-{[2-(3,5-dichloropyridin-2-yl)hydrazinylidene]methyl}-4-methoxyphenol
2-{[2-(3,5-dichloropyridin-2-yl)hydrazinylidene]methyl}-4-methoxyphenol
Compound characteristics
| Compound ID: | 4069-0019 |
| Compound Name: | 2-{[2-(3,5-dichloropyridin-2-yl)hydrazinylidene]methyl}-4-methoxyphenol |
| Molecular Weight: | 312.15 |
| Molecular Formula: | C13 H11 Cl2 N3 O2 |
| Smiles: | COc1ccc(c(/C=N/Nc2c(cc(cn2)[Cl])[Cl])c1)O |
| Stereo: | ACHIRAL |
| logP: | 3.9095 |
| logD: | 3.909 |
| logSw: | -3.749 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.244 |
| InChI Key: | PRDSISMZXWMULU-UHFFFAOYSA-N |