1-(4-methoxyphenyl)-N-[(9,10,11,12-tetrahydro-8H-cyclohepta[4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine
Chemical Structure Depiction of
1-(4-methoxyphenyl)-N-[(9,10,11,12-tetrahydro-8H-cyclohepta[4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine
1-(4-methoxyphenyl)-N-[(9,10,11,12-tetrahydro-8H-cyclohepta[4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine
Compound characteristics
| Compound ID: | 4072-2792 |
| Compound Name: | 1-(4-methoxyphenyl)-N-[(9,10,11,12-tetrahydro-8H-cyclohepta[4,5]thieno[3,2-e][1,2,4]triazolo[1,5-c]pyrimidin-2-yl)methoxy]methanimine |
| Molecular Weight: | 407.49 |
| Molecular Formula: | C21 H21 N5 O2 S |
| Smiles: | COc1ccc(/C=N/OCc2nc3c4c5CCCCCc5sc4N=Cn3n2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.1888 |
| logD: | 4.1871 |
| logSw: | -4.4972 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 59.813 |
| InChI Key: | FFORQTARUSEPOP-UHFFFAOYSA-N |