8,9-bis(4-methoxyphenyl)-2-(thiophen-2-yl)furo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Chemical Structure Depiction of
8,9-bis(4-methoxyphenyl)-2-(thiophen-2-yl)furo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
8,9-bis(4-methoxyphenyl)-2-(thiophen-2-yl)furo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine
Compound characteristics
| Compound ID: | 4072-2814 |
| Compound Name: | 8,9-bis(4-methoxyphenyl)-2-(thiophen-2-yl)furo[3,2-e][1,2,4]triazolo[1,5-c]pyrimidine |
| Molecular Weight: | 454.51 |
| Molecular Formula: | C25 H18 N4 O3 S |
| Smiles: | COc1ccc(cc1)c1c2c3nc(c4cccs4)nn3cnc2oc1c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 5.8909 |
| logD: | 5.8893 |
| logSw: | -6.0884 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.277 |
| InChI Key: | VOTNETAFJCXFNM-UHFFFAOYSA-N |