N'-[(2-methyl-1H-indol-3-yl)methylidene]-3-{2-[(4-methylphenyl)methoxy]phenyl}-1H-pyrazole-5-carbohydrazide
Chemical Structure Depiction of
N'-[(2-methyl-1H-indol-3-yl)methylidene]-3-{2-[(4-methylphenyl)methoxy]phenyl}-1H-pyrazole-5-carbohydrazide
N'-[(2-methyl-1H-indol-3-yl)methylidene]-3-{2-[(4-methylphenyl)methoxy]phenyl}-1H-pyrazole-5-carbohydrazide
Compound characteristics
| Compound ID: | 4076-0294 |
| Compound Name: | N'-[(2-methyl-1H-indol-3-yl)methylidene]-3-{2-[(4-methylphenyl)methoxy]phenyl}-1H-pyrazole-5-carbohydrazide |
| Molecular Weight: | 463.54 |
| Molecular Formula: | C28 H25 N5 O2 |
| Smiles: | Cc1ccc(COc2ccccc2c2cc(C(N/N=C/c3c4ccccc4[nH]c3C)=O)[nH]n2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.2083 |
| logD: | 6.2061 |
| logSw: | -5.7067 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 75.284 |
| InChI Key: | FZTZBLTWRFRJLU-UHFFFAOYSA-N |